Compound Q&A

What industries use p-Tolylmagnesium bromide (CAS: 4294-57-9)?

Answer

p-Tolylmagnesium bromide
p-Tolylmagnesium bromide (CAS: 4294-57-9) is used in the pharmaceutical industry for the synthesis of various organic compounds, in organic synthesis for the preparation of heterocycles, and in the polymer industry for the modification of polymer structures.

About

CAS No 4294-57-9
English Name p-Tolylmagnesium bromide
Molecular Formula C7H7BrMg
Molecular Weight 195.34 g/mol
SMILES CC1=CC=[C-]C=C1.[Mg+2].[Br-]
InChIKey BVUQKCCKUOSAEV-UHFFFAOYSA-M
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of p-Tolylmagnesium bromide (CAS: 4294-57-9)?

p-Tolylmagnesium bromide (CAS: 4294-57-9) is a white crystalline solid. It has a molecular weight of...

Compound Q&A

How is p-Tolylmagnesium bromide (CAS: 4294-57-9) typically synthesized?

p-Tolylmagnesium bromide is typically synthesized by reacting p-tolylmagnesium chloride with sodium ...

Compound Q&A

What precautions should be taken when handling p-Tolylmagnesium bromide (CAS: 4294-57-9)?

When handling p-Tolylmagnesium bromide (CAS: 4294-57-9), use appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...