Compound Q&A

What are the physical and chemical properties of p-Tolylmagnesium bromide (CAS: 4294-57-9)?

Answer

p-Tolylmagnesium bromide
p-Tolylmagnesium bromide (CAS: 4294-57-9) is a white crystalline solid. It has a molecular weight of 167.23 g/mol and is soluble in organic solvents like ethanol and acetone. It is highly reactive and can undergo various nucleophilic substitution reactions.

About

CAS No 4294-57-9
English Name p-Tolylmagnesium bromide
Molecular Formula C7H7BrMg
Molecular Weight 195.34 g/mol
SMILES CC1=CC=[C-]C=C1.[Mg+2].[Br-]
InChIKey BVUQKCCKUOSAEV-UHFFFAOYSA-M
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is p-Tolylmagnesium bromide (CAS: 4294-57-9) typically synthesized?

p-Tolylmagnesium bromide is typically synthesized by reacting p-tolylmagnesium chloride with sodium ...

Compound Q&A

What industries use p-Tolylmagnesium bromide (CAS: 4294-57-9)?

p-Tolylmagnesium bromide (CAS: 4294-57-9) is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling p-Tolylmagnesium bromide (CAS: 4294-57-9)?

When handling p-Tolylmagnesium bromide (CAS: 4294-57-9), use appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...