Compound Q&A

What industries use 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) (CAS: 811862-77-8)?

Answer

1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1)
1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) is used in the pharmaceutical industry for the synthesis of complex molecules and functional groups. It is also employed in the polymer industry for the development of new materials with tailored properties. Additionally, it finds applications in the development of sensors and semiconductors due to its unique chemical reactivity.

About

English Name 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1)
Molecular Formula C42H52O10Pd
Molecular Weight 823.29 g/mol
SMILES COC1=CC(=CC(=C1)C=CC(=O)C=CC2=CC(=CC(=C2)OC)OC)OC.COC1=CC(=CC(=C1)C=CC(=O)C=CC2=CC(=CC(=C2)OC)OC)OC.[Pd]
InChIKey ULLMBNNTRAJXJK-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) (CAS: 811862-77-8)?

1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) is a crystalline compound with a molecula...

Compound Q&A

How is 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) (CAS: 811862-77-8) typically synthesized?

1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) can be synthesized through a palladium-ca...

Compound Q&A

What precautions should be taken when handling 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) (CAS: 811862-77-8)?

When handling 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...