Compound Q&A

What are the physical and chemical properties of 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) (CAS: 811862-77-8)?

Answer

1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1)
1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) is a crystalline compound with a molecular weight of approximately 488.4 g/mol. It has low water solubility but good solubility in organic solvents such as methanol and dichloromethane. The compound exhibits limited reactivity under normal conditions but can undergo palladium-catalyzed reactions under optimized conditions.

About

English Name 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1)
Molecular Formula C42H52O10Pd
Molecular Weight 823.29 g/mol
SMILES COC1=CC(=CC(=C1)C=CC(=O)C=CC2=CC(=CC(=C2)OC)OC)OC.COC1=CC(=CC(=C1)C=CC(=O)C=CC2=CC(=CC(=C2)OC)OC)OC.[Pd]
InChIKey ULLMBNNTRAJXJK-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) (CAS: 811862-77-8) typically synthesized?

1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) can be synthesized through a palladium-ca...

Compound Q&A

What industries use 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) (CAS: 811862-77-8)?

1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) is used in the pharmaceutical industry fo...

Compound Q&A

What precautions should be taken when handling 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1) (CAS: 811862-77-8)?

When handling 1,5-Bis(3,5-dimethoxyphenyl)-3-pentanone - palladium (2:1), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...