Compound Q&A

What industries use Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

Answer

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (1:2:2)
Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) is used in various industries including pharmaceuticals, where it serves as a chelating agent, and in polymers, where it enhances properties. It is also utilized in the production of sensors, semiconductors, and in other applications requiring specific reactivity and solubility characteristics.

About

CAS No 36673-16-2
English Name Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (1:2:2)
Molecular Formula C18H42N2O8Ti
Molecular Weight 462.41 g/mol
EINECS 253-153-2
SMILES OCCN(CCO[Ti](OC(C)C)(OC(C)C)OCCN(CCO)CCO)CCO
InChIKey XAVMMNWPOYCFPU-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) is a crystalline...

Compound Q&A

How is Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) typically synthesized?

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate is typically synthesized via a mul...

Compound Q&A

What precautions should be taken when handling Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

When handling Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...