Compound Q&A

What are the physical and chemical properties of Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

Answer

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (1:2:2)
Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) is a crystalline compound with a high molecular weight. It is moderately soluble in water and ethanol. The compound is reactive with acids and bases. It has good thermal stability but may decompose at high temperatures. This compound is often used in chemical synthesis due to its reactivity and complex structure.

About

CAS No 36673-16-2
English Name Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (1:2:2)
Molecular Formula C18H42N2O8Ti
Molecular Weight 462.41 g/mol
EINECS 253-153-2
SMILES OCCN(CCO[Ti](OC(C)C)(OC(C)C)OCCN(CCO)CCO)CCO
InChIKey XAVMMNWPOYCFPU-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) typically synthesized?

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate is typically synthesized via a mul...

Compound Q&A

What industries use Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) is used in vario...

Compound Q&A

What precautions should be taken when handling Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

When handling Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...