Compound Q&A

How is Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) typically synthesized?

Answer

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (1:2:2)
Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate is typically synthesized via a multi-step process involving titanium tetrachloride, amines, and propanol. The reaction usually requires a solvent such as water or an alcohol and is conducted under mild conditions. The yield is generally good, and the product is isolated by filtration and recrystallization.

About

CAS No 36673-16-2
English Name Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (1:2:2)
Molecular Formula C18H42N2O8Ti
Molecular Weight 462.41 g/mol
EINECS 253-153-2
SMILES OCCN(CCO[Ti](OC(C)C)(OC(C)C)OCCN(CCO)CCO)CCO
InChIKey XAVMMNWPOYCFPU-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) is a crystalline...

Compound Q&A

What industries use Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2) is used in vario...

Compound Q&A

What precautions should be taken when handling Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2)?

When handling Titanium(4+) 2-[bis(2-hydroxyethyl)amino]ethanolate 2-propanolate (CAS: 36673-16-2), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...