Compound Q&A

What industries use 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

Answer

2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate
This compound is utilized in various industries, including pharmaceuticals, where it serves as a precursor in the synthesis of certain drug molecules. It is also employed in the polymer industry for modifying polymer properties and in the sensor industry for developing chemical sensors due to its specific reactivity. Additionally, it is used in the semiconductor industry for specific applications requiring precise chemical functionalities.

About

English Name 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate
Molecular Formula C10H19NO3
Molecular Weight 201.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)CO
InChIKey HKIGXXRMJFUUKV-MRVPVSSYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate is a crystalline compound with a...

Compound Q&A

How is 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2) typically synthesized?

This compound is typically synthesized via a multistep process involving the reaction of 2-methyl-2-...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

When handling 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...