Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

Answer

2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate
2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate is a crystalline compound with a molecular weight of approximately 245.3 g/mol. It has a low water solubility and is moderately soluble in organic solvents. This compound exhibits reactivity towards nucleophiles and can undergo esterification reactions. It is stable under normal laboratory conditions but should be stored in a dry environment to prevent hydrolysis.

About

English Name 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate
Molecular Formula C10H19NO3
Molecular Weight 201.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)CO
InChIKey HKIGXXRMJFUUKV-MRVPVSSYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2) typically synthesized?

This compound is typically synthesized via a multistep process involving the reaction of 2-methyl-2-...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

This compound is utilized in various industries, including pharmaceuticals, where it serves as a pre...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

When handling 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...