Compound Q&A

How is 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2) typically synthesized?

Answer

2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate
This compound is typically synthesized via a multistep process involving the reaction of 2-methyl-2-propanol with 3-(hydroxymethyl)-1-pyrrolidinecarboxylic acid. Commonly, acylation reactions are used to form the ester. The conditions include the use of a suitable base and catalyst, and the reaction is carried out in an organic solvent at a controlled temperature. The product is isolated by recrystallization to obtain a high-purity crystalline form.

About

English Name 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate
Molecular Formula C10H19NO3
Molecular Weight 201.27 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(C1)CO
InChIKey HKIGXXRMJFUUKV-MRVPVSSYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate is a crystalline compound with a...

Compound Q&A

What industries use 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

This compound is utilized in various industries, including pharmaceuticals, where it serves as a pre...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate (CAS: 138108-72-2)?

When handling 2-Methyl-2-propanyl (3R)-3-(hydroxymethyl)-1-pyrrolidinecarboxylate, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...