Compound Q&A

What industries use 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

Answer

4-Nitro-N-phenylaniline
4-Nitro-N-phenylaniline (CAS: 836-30-6) is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drugs. It is also used in the production of dyes, pigments, and other organic compounds. Additionally, it has applications in polymers and sensors due to its reactivity and functional groups.

About

CAS No 836-30-6
English Name 4-Nitro-N-phenylaniline
Molecular Formula C12H10N2O2
Molecular Weight 214.22 g/mol
SMILES C1=CC=C(C=C1)NC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey XXYMSQQCBUKFHE-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

4-Nitro-N-phenylaniline (CAS: 836-30-6) is a light yellow crystalline solid. Its molecular weight is...

Compound Q&A

How is 4-Nitro-N-phenylaniline (CAS: 836-30-6) typically synthesized?

4-Nitro-N-phenylaniline (CAS: 836-30-6) is commonly synthesized by nitration of N-phenylaniline usin...

Compound Q&A

What precautions should be taken when handling 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

When handling 4-Nitro-N-phenylaniline (CAS: 836-30-6), it is essential to use personal protective eq...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...