Compound Q&A

What are the physical and chemical properties of 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

Answer

4-Nitro-N-phenylaniline
4-Nitro-N-phenylaniline (CAS: 836-30-6) is a light yellow crystalline solid. Its molecular weight is approximately 228.14 g/mol. It has a melting point of 125-127°C and is slightly soluble in water. This compound is reactive towards nucleophiles and electrophiles. It can undergo nitration, sulfonation, and coupling reactions under appropriate conditions.

About

CAS No 836-30-6
English Name 4-Nitro-N-phenylaniline
Molecular Formula C12H10N2O2
Molecular Weight 214.22 g/mol
SMILES C1=CC=C(C=C1)NC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey XXYMSQQCBUKFHE-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is 4-Nitro-N-phenylaniline (CAS: 836-30-6) typically synthesized?

4-Nitro-N-phenylaniline (CAS: 836-30-6) is commonly synthesized by nitration of N-phenylaniline usin...

Compound Q&A

What industries use 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

4-Nitro-N-phenylaniline (CAS: 836-30-6) is primarily used in the pharmaceutical industry as a precur...

Compound Q&A

What precautions should be taken when handling 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

When handling 4-Nitro-N-phenylaniline (CAS: 836-30-6), it is essential to use personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...