Compound Q&A

What are the physical and chemical properties of 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

Answer

4-Nitro-N-phenylaniline
4-Nitro-N-phenylaniline (CAS: 836-30-6) is a light yellow crystalline solid. Its molecular weight is approximately 228.14 g/mol. It has a melting point of 125-127°C and is slightly soluble in water. This compound is reactive towards nucleophiles and electrophiles. It can undergo nitration, sulfonation, and coupling reactions under appropriate conditions.

About

CAS No 836-30-6
English Name 4-Nitro-N-phenylaniline
Molecular Formula C12H10N2O2
Molecular Weight 214.22 g/mol
SMILES C1=CC=C(C=C1)NC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey XXYMSQQCBUKFHE-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is 4-Nitro-N-phenylaniline (CAS: 836-30-6) typically synthesized?

4-Nitro-N-phenylaniline (CAS: 836-30-6) is commonly synthesized by nitration of N-phenylaniline usin...

Compound Q&A

What industries use 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

4-Nitro-N-phenylaniline (CAS: 836-30-6) is primarily used in the pharmaceutical industry as a precur...

Compound Q&A

What precautions should be taken when handling 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

When handling 4-Nitro-N-phenylaniline (CAS: 836-30-6), it is essential to use personal protective eq...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...