Compound Q&A

How is 4-Nitro-N-phenylaniline (CAS: 836-30-6) typically synthesized?

Answer

4-Nitro-N-phenylaniline
4-Nitro-N-phenylaniline (CAS: 836-30-6) is commonly synthesized by nitration of N-phenylaniline using concentrated nitric acid and sulfuric acid as the catalyst. The reaction is carried out under carefully controlled conditions to ensure high yield and selectivity. The product can be purified by recrystallization from ethanol or acetone.

About

CAS No 836-30-6
English Name 4-Nitro-N-phenylaniline
Molecular Formula C12H10N2O2
Molecular Weight 214.22 g/mol
SMILES C1=CC=C(C=C1)NC2=CC=C(C=C2)[N+](=O)[O-]
InChIKey XXYMSQQCBUKFHE-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

4-Nitro-N-phenylaniline (CAS: 836-30-6) is a light yellow crystalline solid. Its molecular weight is...

Compound Q&A

What industries use 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

4-Nitro-N-phenylaniline (CAS: 836-30-6) is primarily used in the pharmaceutical industry as a precur...

Compound Q&A

What precautions should be taken when handling 4-Nitro-N-phenylaniline (CAS: 836-30-6)?

When handling 4-Nitro-N-phenylaniline (CAS: 836-30-6), it is essential to use personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...