Compound Q&A

What industries use 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate (CAS: 37687-24-4)?

Answer

3,5-diethyl 1H-pyrazole-3,5-dicarboxylate
3,5-diethyl 1H-pyrazole-3,5-dicarboxylate is used in various industries, including pharmaceuticals for its potential as a drug candidate, and in polymers for its ability to enhance certain physical properties. It is also utilized in the development of sensors and semiconductors due to its unique chemical structure.

About

CAS No 37687-24-4
English Name 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate
Molecular Formula C9H12N2O4
Molecular Weight 212.2 g/mol
SMILES CCOC(=O)C1=CC(=NN1)C(=O)OCC
InChIKey MBWXLICVQZUJOW-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate (CAS: 37687-24-4)?

3,5-diethyl 1H-pyrazole-3,5-dicarboxylate is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate (CAS: 37687-24-4) typically synthesized?

3,5-diethyl 1H-pyrazole-3,5-dicarboxylate is commonly synthesized via the reaction of a diethyl pyra...

Compound Q&A

What precautions should be taken when handling 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate (CAS: 37687-24-4)?

Proper handling of 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate requires the use of personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...