Compound Q&A

What are the physical and chemical properties of 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate (CAS: 37687-24-4)?

Answer

3,5-diethyl 1H-pyrazole-3,5-dicarboxylate
3,5-diethyl 1H-pyrazole-3,5-dicarboxylate is a white crystalline solid with a molecular weight of approximately 210.26 g/mol. It has a high solubility in organic solvents like dimethylformamide and moderate solubility in water. The compound exhibits good reactivity, particularly towards nucleophilic substitution and esterification reactions.

About

CAS No 37687-24-4
English Name 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate
Molecular Formula C9H12N2O4
Molecular Weight 212.2 g/mol
SMILES CCOC(=O)C1=CC(=NN1)C(=O)OCC
InChIKey MBWXLICVQZUJOW-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate (CAS: 37687-24-4) typically synthesized?

3,5-diethyl 1H-pyrazole-3,5-dicarboxylate is commonly synthesized via the reaction of a diethyl pyra...

Compound Q&A

What industries use 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate (CAS: 37687-24-4)?

3,5-diethyl 1H-pyrazole-3,5-dicarboxylate is used in various industries, including pharmaceuticals f...

Compound Q&A

What precautions should be taken when handling 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate (CAS: 37687-24-4)?

Proper handling of 3,5-diethyl 1H-pyrazole-3,5-dicarboxylate requires the use of personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...