Compound Q&A

What precautions should be taken when handling trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

Answer

trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline
When handling trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0), it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to dust and vapors. Spills should be handled carefully, and appropriate cleanup procedures should be followed. Always consult the Safety Data Sheet (SDS) for detailed information on handling and disposal.

About

CAS No 96034-57-0
English Name trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline
Molecular Formula C13H14N2O7
Molecular Weight 310.26 g/mol
SMILES C1C(CN(C1C(=O)O)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])O
InChIKey JMJMJDNHVXYAOC-MNOVXSKESA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is a crystalline compound w...

Compound Q&A

How is trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) typically synthesized?

Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is typically synthesized vi...

Compound Q&A

What industries use trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is primarily used in the ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...