Compound Q&A

What are the physical and chemical properties of trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

Answer

trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline
Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is a crystalline compound with a molecular weight of approximately 331.07 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. It is moderately reactive, particularly under basic conditions. The compound can form stable esters and amides, and it is used in various synthetic transformations.

About

CAS No 96034-57-0
English Name trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline
Molecular Formula C13H14N2O7
Molecular Weight 310.26 g/mol
SMILES C1C(CN(C1C(=O)O)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])O
InChIKey JMJMJDNHVXYAOC-MNOVXSKESA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) typically synthesized?

Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is typically synthesized vi...

Compound Q&A

What industries use trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

When handling trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...