Compound Q&A

How is trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) typically synthesized?

Answer

trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline
Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is typically synthesized via a multi-step process involving the protection of L-proline with a benzyloxycarbonyl group, followed by the introduction of the hydroxy group and nitration of the aromatic ring. The synthesis often requires the use of reagents like p-nitrobenzyl chloride, hydroxylation catalysts, and nitration agents like nitric acid. The yield and selectivity can be optimized using appropriate reaction conditions and purification techniques.

About

CAS No 96034-57-0
English Name trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline
Molecular Formula C13H14N2O7
Molecular Weight 310.26 g/mol
SMILES C1C(CN(C1C(=O)O)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])O
InChIKey JMJMJDNHVXYAOC-MNOVXSKESA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is a crystalline compound w...

Compound Q&A

What industries use trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

Trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0)?

When handling trans-4-Hydroxy-1-(4-nitrobenzyloxycarbonyl)-L-proline (CAS: 96034-57-0), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...