Compound Q&A

What industries use 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

Answer

1,2,3-Propanetriyl tripropanoate
1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is primarily used in the pharmaceutical industry as a precursor in the synthesis of drugs. It also finds applications in the polymer industry for the modification of polymer properties. Due to its chemical structure, it can be used in the production of certain types of sensors and in the electronics industry for semiconductor applications.

About

CAS No 139-45-7
English Name 1,2,3-Propanetriyl tripropanoate
Molecular Formula C12H20O6
Molecular Weight 260.28599999999994 g/mol
SMILES CCC(=O)OC(COC(=O)CC)COC(=O)CC
InChIKey YZWRNSARCRTXDS-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is a colorless liquid with a faint odor. It has a m...

Compound Q&A

How is 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) typically synthesized?

1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is typically synthesized by the esterification of p...

Compound Q&A

What precautions should be taken when handling 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

When handling 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7), it is important to wear appropriate ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...