Compound Q&A

How is 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) typically synthesized?

Answer

1,2,3-Propanetriyl tripropanoate
1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is typically synthesized by the esterification of propanol with propionic acid. The reaction is carried out in the presence of a strong acid catalyst, such as sulfuric acid, at a temperature of around 100°C. The reaction is known to be selective and yields a high percentage of the desired product, with the main byproduct being water.

About

CAS No 139-45-7
English Name 1,2,3-Propanetriyl tripropanoate
Molecular Formula C12H20O6
Molecular Weight 260.29 g/mol
SMILES CCC(=O)OC(COC(=O)CC)COC(=O)CC
InChIKey YZWRNSARCRTXDS-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is a colorless liquid with a faint odor. It has a m...

Compound Q&A

What industries use 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

When handling 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7), it is important to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...