Compound Q&A

What are the physical and chemical properties of 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

Answer

1,2,3-Propanetriyl tripropanoate
1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is a colorless liquid with a faint odor. It has a molecular weight of approximately 242.43 g/mol. This compound is moderately soluble in water but soluble in ethanol and other common organic solvents. It is known for its low reactivity, making it stable under normal conditions. However, like many organic compounds, it may decompose at high temperatures or under strong acidic or basic conditions.

About

CAS No 139-45-7
English Name 1,2,3-Propanetriyl tripropanoate
Molecular Formula C12H20O6
Molecular Weight 260.28599999999994 g/mol
SMILES CCC(=O)OC(COC(=O)CC)COC(=O)CC
InChIKey YZWRNSARCRTXDS-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) typically synthesized?

1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is typically synthesized by the esterification of p...

Compound Q&A

What industries use 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7) is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7)?

When handling 1,2,3-Propanetriyl tripropanoate (CAS: 139-45-7), it is important to wear appropriate ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...