Compound Q&A

What industries use ophiopojaponin C (CAS: 911819-08-4)?

Answer

ophiopojaponin C
Ophiopojaponin C (CAS: 911819-08-4) is primarily used in the pharmaceutical industry for its potential biological activities, including anti-inflammatory and antitumor properties. It is also explored in the natural product chemistry field for its structural complexity and biological interest. Limited applications are found in food additives and cosmetics due to its specialized nature.

About

English Name ophiopojaponin C
Molecular Formula C46H72O17
Molecular Weight 897.07 g/mol
SMILES CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(C(CC(C6)OC(=O)C)OC7C(C(C(C(O7)C)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1
InChIKey MQTJXIHSKXORQL-RFMZWHELSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of ophiopojaponin C (CAS: 911819-08-4)?

Ophiopojaponin C (CAS: 911819-08-4) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is ophiopojaponin C (CAS: 911819-08-4) typically synthesized?

Ophiopojaponin C (CAS: 911819-08-4) is typically synthesized through bio-synthetic pathways involvin...

Compound Q&A

What precautions should be taken when handling ophiopojaponin C (CAS: 911819-08-4)?

When handling ophiopojaponin C (CAS: 911819-08-4), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...