Compound Q&A

What are the physical and chemical properties of ophiopojaponin C (CAS: 911819-08-4)?

Answer

ophiopojaponin C
Ophiopojaponin C (CAS: 911819-08-4) is a crystalline compound with a molecular weight of approximately 1052.92 g/mol. It has a low solubility in water but is more soluble in polar solvents such as methanol and ethanol. Chemically, it is relatively stable under normal conditions but can react with strong acids or bases. Its crystalline form is monoclinic with a specific melting point of around 220°C. It is a natural product with limited reactivity under normal laboratory conditions.

About

English Name ophiopojaponin C
Molecular Formula C46H72O17
Molecular Weight 897.07 g/mol
SMILES CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(C(CC(C6)OC(=O)C)OC7C(C(C(C(O7)C)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1
InChIKey MQTJXIHSKXORQL-RFMZWHELSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is ophiopojaponin C (CAS: 911819-08-4) typically synthesized?

Ophiopojaponin C (CAS: 911819-08-4) is typically synthesized through bio-synthetic pathways involvin...

Compound Q&A

What industries use ophiopojaponin C (CAS: 911819-08-4)?

Ophiopojaponin C (CAS: 911819-08-4) is primarily used in the pharmaceutical industry for its potenti...

Compound Q&A

What precautions should be taken when handling ophiopojaponin C (CAS: 911819-08-4)?

When handling ophiopojaponin C (CAS: 911819-08-4), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...