Compound Q&A

How is ophiopojaponin C (CAS: 911819-08-4) typically synthesized?

Answer

ophiopojaponin C
Ophiopojaponin C (CAS: 911819-08-4) is typically synthesized through bio-synthetic pathways involving fungal or plant extracts. Chemical synthesis can also be achieved through complex multi-step reactions involving coupling, esterification, and condensation steps. The yield is moderate, and selectivity can be improved with specific catalysts and reagents. Commonly used solvents include acetonitrile and dichloromethane.

About

English Name ophiopojaponin C
Molecular Formula C46H72O17
Molecular Weight 897.07 g/mol
SMILES CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(C(CC(C6)OC(=O)C)OC7C(C(C(C(O7)C)O)OC8C(C(C(CO8)O)O)O)OC9C(C(C(C(O9)C)O)O)O)C)C)C)OC1
InChIKey MQTJXIHSKXORQL-RFMZWHELSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of ophiopojaponin C (CAS: 911819-08-4)?

Ophiopojaponin C (CAS: 911819-08-4) is a crystalline compound with a molecular weight of approximate...

Compound Q&A

What industries use ophiopojaponin C (CAS: 911819-08-4)?

Ophiopojaponin C (CAS: 911819-08-4) is primarily used in the pharmaceutical industry for its potenti...

Compound Q&A

What precautions should be taken when handling ophiopojaponin C (CAS: 911819-08-4)?

When handling ophiopojaponin C (CAS: 911819-08-4), it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...