Compound Q&A

What industries use 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride (CAS: 94240-17-2)?

Answer

1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride
1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride is used in the pharmaceutical industry for the synthesis of certain drugs. It is also applied in the polymer industry to enhance the functionality of polymers. Additionally, it is used in the production of sensors and semiconductors for its unique chemical properties.

About

CAS No 94240-17-2
English Name 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride
Molecular Formula C9H12ClNO2
Molecular Weight 201.65 g/mol
SMILES CNCC(=O)C1=CC(=CC=C1)O.Cl
InChIKey DEOGEZWYKPQJLP-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride (CAS: 94240-17-2)?

1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride is a white crystalline solid with a molecu...

Compound Q&A

How is 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride (CAS: 94240-17-2) typically synthesized?

1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride is typically synthesized via the condensat...

Compound Q&A

What precautions should be taken when handling 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride (CAS: 94240-17-2)?

When handling 1-(3-Hydroxyphenyl)-2-(methylamino)ethanone hydrochloride, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...