Compound Q&A

What industries use 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is primarily used in the pharmaceutical and polymer industries. It serves as a building block for synthesizing various drug candidates and has applications in the development of functional polymers. Additionally, this compound can be used in the production of sensors and semiconductors due to its chemical reactivity and stability.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
Molecular Formula C12H21NO4
Molecular Weight 243.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C(=O)OC
InChIKey PVMJFJDVCVNWQN-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is a crystalline com...

Compound Q&A

How is 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) typically synthesized?

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is typically synthes...

Compound Q&A

What precautions should be taken when handling 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

When handling 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...