Compound Q&A

What are the physical and chemical properties of 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is a crystalline compound with a molecular weight of approximately 284.43 g/mol. It has a low solubility in water but is soluble in common organic solvents. This compound is known for its reactivity in esterification and amidation reactions. It forms colorless crystals that are stable under normal conditions but should be handled with care due to its chemical reactivity.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
Molecular Formula C12H21NO4
Molecular Weight 243.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C(=O)OC
InChIKey PVMJFJDVCVNWQN-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) typically synthesized?

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is typically synthes...

Compound Q&A

What industries use 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is primarily used in...

Compound Q&A

What precautions should be taken when handling 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

When handling 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...