Compound Q&A

How is 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) typically synthesized?

Answer

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is typically synthesized through a series of esterification and amidation reactions. Common synthetic methods involve the use of piperidine derivatives and appropriate carboxylic acids. The synthesis often requires the use of catalysts such as p-toluenesulfonic acid (PTSA) and proceeds with high selectivity and yield, making it a reliable method for industrial production.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate
Molecular Formula C12H21NO4
Molecular Weight 243.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C(=O)OC
InChIKey PVMJFJDVCVNWQN-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is a crystalline com...

Compound Q&A

What industries use 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0) is primarily used in...

Compound Q&A

What precautions should be taken when handling 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0)?

When handling 2-Methyl 1-(2-methyl-2-propanyl) 1,2-piperidinedicarboxylate (CAS: 167423-93-0), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...