Compound Q&A

What precautions should be taken when handling (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

Answer

(2,4,6-Triisopropylphenyl)boronic acid
When handling (2,4,6-Triisopropylphenyl)boronic acid, it is important to wear appropriate personal protective equipment (PPE), including gloves and safety glasses. The substance should be stored under nitrogen to prevent oxidation. In case of a spill, it should be handled in a fume hood, and proper safety data sheets (SDS) should be consulted for detailed guidance on spill cleanup and disposal.

About

English Name (2,4,6-Triisopropylphenyl)boronic acid
Molecular Formula C15H25BO2
Molecular Weight 248.17 g/mol
SMILES B(C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)(O)O
InChIKey FGFYEKLWZBTLEW-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

(2,4,6-Triisopropylphenyl)boronic acid is a white to off-white crystalline solid with a molecular we...

Compound Q&A

How is (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9) typically synthesized?

(2,4,6-Triisopropylphenyl)boronic acid is typically synthesized by the reaction of 2,4,6-triisopropy...

Compound Q&A

What industries use (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

(2,4,6-Triisopropylphenyl)boronic acid finds applications in pharmaceuticals, where it is used in th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...