Compound Q&A

What are the physical and chemical properties of (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

Answer

(2,4,6-Triisopropylphenyl)boronic acid
(2,4,6-Triisopropylphenyl)boronic acid is a white to off-white crystalline solid with a molecular weight of approximately 358.43 g/mol. It is slightly soluble in water and ethanol. The compound is relatively stable but can react with strong acids and bases. It is used in various synthetic reactions due to its reactivity with organoboron reagents.

About

English Name (2,4,6-Triisopropylphenyl)boronic acid
Molecular Formula C15H25BO2
Molecular Weight 248.17 g/mol
SMILES B(C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)(O)O
InChIKey FGFYEKLWZBTLEW-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9) typically synthesized?

(2,4,6-Triisopropylphenyl)boronic acid is typically synthesized by the reaction of 2,4,6-triisopropy...

Compound Q&A

What industries use (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

(2,4,6-Triisopropylphenyl)boronic acid finds applications in pharmaceuticals, where it is used in th...

Compound Q&A

What precautions should be taken when handling (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

When handling (2,4,6-Triisopropylphenyl)boronic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...