Compound Q&A

What industries use (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

Answer

(2,4,6-Triisopropylphenyl)boronic acid
(2,4,6-Triisopropylphenyl)boronic acid finds applications in pharmaceuticals, where it is used in the synthesis of certain drug intermediates. It is also utilized in the production of functionalized compounds for use in polymers and sensors. Additionally, it plays a role in the development of materials for semiconductors.

About

English Name (2,4,6-Triisopropylphenyl)boronic acid
Molecular Formula C15H25BO2
Molecular Weight 248.17 g/mol
SMILES B(C1=C(C=C(C=C1C(C)C)C(C)C)C(C)C)(O)O
InChIKey FGFYEKLWZBTLEW-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

(2,4,6-Triisopropylphenyl)boronic acid is a white to off-white crystalline solid with a molecular we...

Compound Q&A

How is (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9) typically synthesized?

(2,4,6-Triisopropylphenyl)boronic acid is typically synthesized by the reaction of 2,4,6-triisopropy...

Compound Q&A

What precautions should be taken when handling (2,4,6-Triisopropylphenyl)boronic acid (CAS: 154549-38-9)?

When handling (2,4,6-Triisopropylphenyl)boronic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...