Compound Q&A

What industries use TOTU (CAS: 136849-72-4)?

Answer

TOTU
TOTU (CAS: 136849-72-4) is primarily used in the pharmaceutical industry for the synthesis of biologically active molecules. It is also utilized in the polymer industry for the preparation of specialized polymers and in the sensor and semiconductor industries for the development of sensing materials and components.

About

English Name TOTU
Molecular Formula C10H17BF4N4O3
Molecular Weight 328.07 g/mol
SMILES [B-](F)(F)(F)F.CCOC(=O)C(=NOC(=[N+](C)C)N(C)C)C#N
InChIKey FPQVGDGSRVMNMR-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of TOTU (CAS: 136849-72-4)?

TOTU (CAS: 136849-72-4) is a white crystalline solid with a molecular weight of approximately 318.19...

Compound Q&A

How is TOTU (CAS: 136849-72-4) typically synthesized?

TOTU (CAS: 136849-72-4) is synthesized through the alkylation of an appropriate thioester with an or...

Compound Q&A

What precautions should be taken when handling TOTU (CAS: 136849-72-4)?

When handling TOTU (CAS: 136849-72-4), it is essential to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...