Compound Q&A

What are the physical and chemical properties of TOTU (CAS: 136849-72-4)?

Answer

TOTU
TOTU (CAS: 136849-72-4) is a white crystalline solid with a molecular weight of approximately 318.19 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and acetonitrile. TOTU is known to be a highly reactive compound, readily forming adducts with nucleophiles and is used in organic synthesis due to its reactivity.

About

English Name TOTU
Molecular Formula C10H17BF4N4O3
Molecular Weight 328.07 g/mol
SMILES [B-](F)(F)(F)F.CCOC(=O)C(=NOC(=[N+](C)C)N(C)C)C#N
InChIKey FPQVGDGSRVMNMR-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is TOTU (CAS: 136849-72-4) typically synthesized?

TOTU (CAS: 136849-72-4) is synthesized through the alkylation of an appropriate thioester with an or...

Compound Q&A

What industries use TOTU (CAS: 136849-72-4)?

TOTU (CAS: 136849-72-4) is primarily used in the pharmaceutical industry for the synthesis of biolog...

Compound Q&A

What precautions should be taken when handling TOTU (CAS: 136849-72-4)?

When handling TOTU (CAS: 136849-72-4), it is essential to wear appropriate personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...