Compound Q&A

What industries use 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

Answer

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone
4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is used in various industries, including pharmaceuticals for developing organic dyes and pigments, polymers for electronic applications, sensors for detecting specific chemicals, and semiconductors in organic light-emitting diodes (OLEDs). Its unique electronic properties make it valuable in these fields.

About

CAS No 4051-63-2
English Name 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone
Molecular Formula C28H16N2O4
Molecular Weight 444.45 g/mol
SMILES O=C1C2=C(C=CC=C2)C(C3=C(N)C=CC(C(C=CC(N)=C4C(C5=C6C=CC=C5)=O)=C4C6=O)=C13)=O
InChIKey KNMQFBWXSICVQC-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is a crystalline compound with a...

Compound Q&A

How is 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) typically synthesized?

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is typically synthesized through...

Compound Q&A

What precautions should be taken when handling 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

When handling 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2), wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...