Compound Q&A

What are the physical and chemical properties of 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

Answer

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone
4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is a crystalline compound with a high molecular weight. It has a low solubility in water but is more soluble in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). Chemically, it is highly reactive, particularly towards electrophilic aromatic substitution reactions. It exhibits strong electronic properties suitable for applications in organic electronics and photovoltaics.

About

CAS No 4051-63-2
English Name 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone
Molecular Formula C28H16N2O4
Molecular Weight 444.45 g/mol
SMILES O=C1C2=C(C=CC=C2)C(C3=C(N)C=CC(C(C=CC(N)=C4C(C5=C6C=CC=C5)=O)=C4C6=O)=C13)=O
InChIKey KNMQFBWXSICVQC-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) typically synthesized?

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is typically synthesized through...

Compound Q&A

What industries use 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is used in various industries, i...

Compound Q&A

What precautions should be taken when handling 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

When handling 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2), wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...