Compound Q&A

How is 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) typically synthesized?

Answer

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone
4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is typically synthesized through a series of steps involving the condensation of anthracene derivatives followed by aromatic diazonium coupling and reduction. Common catalysts include palladium and platinum complexes. The reaction conditions are carefully controlled to achieve high selectivity and yield.

About

CAS No 4051-63-2
English Name 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone
Molecular Formula C28H16N2O4
Molecular Weight 444.45 g/mol
SMILES O=C1C2=C(C=CC=C2)C(C3=C(N)C=CC(C(C=CC(N)=C4C(C5=C6C=CC=C5)=O)=C4C6=O)=C13)=O
InChIKey KNMQFBWXSICVQC-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is a crystalline compound with a...

Compound Q&A

What industries use 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2) is used in various industries, i...

Compound Q&A

What precautions should be taken when handling 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2)?

When handling 4,4'-Diamino-1,1'-bianthracene-9,9',10,10'-tetrone (CAS: 4051-63-2), wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...