Compound Q&A

What precautions should be taken when handling (1S)-(+)-(10-Camphorsulfonyl)oxaziridine (CAS: 104322-63-6)?

Answer

(1S)-(+)-(10-Camphorsulfonyl)oxaziridine
When handling (1S)-(+)-(10-Camphorsulfonyl)oxaziridine, it is crucial to use appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a laboratory coat. This compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be carefully cleaned up using appropriate absorbents and disposed of according to local regulations. Always consult the Material Safety Data Sheet (MSDS) for detailed safety guidelines.

About

English Name (1S)-(+)-(10-Camphorsulfonyl)oxaziridine
Molecular Formula C10H15NO3S
Molecular Weight 229.3 g/mol
SMILES CC1(C2CCC13CS(=O)(=O)N4C3(C2)O4)C
InChIKey GBBJBUGPGFNISJ-YDQXZVTASA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1S)-(+)-(10-Camphorsulfonyl)oxaziridine (CAS: 104322-63-6)?

(1S)-(+)-(10-Camphorsulfonyl)oxaziridine is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is (1S)-(+)-(10-Camphorsulfonyl)oxaziridine (CAS: 104322-63-6) typically synthesized?

(1S)-(+)-(10-Camphorsulfonyl)oxaziridine is usually synthesized by the reaction of camphorsulfonic a...

Compound Q&A

What industries use (1S)-(+)-(10-Camphorsulfonyl)oxaziridine (CAS: 104322-63-6)?

(1S)-(+)-(10-Camphorsulfonyl)oxaziridine is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...