Compound Q&A

How is (1S)-(+)-(10-Camphorsulfonyl)oxaziridine (CAS: 104322-63-6) typically synthesized?

Answer

(1S)-(+)-(10-Camphorsulfonyl)oxaziridine
(1S)-(+)-(10-Camphorsulfonyl)oxaziridine is usually synthesized by the reaction of camphorsulfonic acid with oxaziridine. This process involves the condensation of camphorsulfonic acid with an appropriate aldehyde or ketone under acidic conditions, followed by treatment with a reducing agent to form the oxaziridine ring. The reaction is typically carried out in the presence of a suitable catalyst to enhance the yield and selectivity.

About

English Name (1S)-(+)-(10-Camphorsulfonyl)oxaziridine
Molecular Formula C10H15NO3S
Molecular Weight 229.3 g/mol
SMILES CC1(C2CCC13CS(=O)(=O)N4C3(C2)O4)C
InChIKey GBBJBUGPGFNISJ-YDQXZVTASA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1S)-(+)-(10-Camphorsulfonyl)oxaziridine (CAS: 104322-63-6)?

(1S)-(+)-(10-Camphorsulfonyl)oxaziridine is a white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use (1S)-(+)-(10-Camphorsulfonyl)oxaziridine (CAS: 104322-63-6)?

(1S)-(+)-(10-Camphorsulfonyl)oxaziridine is primarily used in the pharmaceutical industry for the sy...

Compound Q&A

What precautions should be taken when handling (1S)-(+)-(10-Camphorsulfonyl)oxaziridine (CAS: 104322-63-6)?

When handling (1S)-(+)-(10-Camphorsulfonyl)oxaziridine, it is crucial to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...