Compound Q&A

How is 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7) typically synthesized?

Answer

1,2,3-Propanetriyl triheptanoate
1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7) is typically synthesized by esterification of heptanoic acid with 1,2,3-propanetriol. This process involves heating the reactants in the presence of a catalyst such as sulfuric acid or a solid acid catalyst. The reaction is conducted under reflux conditions, and the product is isolated by distillation. The yield and selectivity are influenced by the reaction conditions and catalyst choice.

About

CAS No 620-67-7
English Name 1,2,3-Propanetriyl triheptanoate
Molecular Formula C24H44O6
Molecular Weight 428.61 g/mol
SMILES CCCCCCC(=O)OCC(COC(=O)CCCCCC)OC(=O)CCCCCC
InChIKey PJHKBYALYHRYSK-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7)?

1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7) is a clear, colorless liquid at room temperature. I...

Compound Q&A

What industries use 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7)?

1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7) is commonly used in the food and cosmetic industrie...

Compound Q&A

What precautions should be taken when handling 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7)?

When handling 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7), it is important to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...