Compound Q&A

What are the physical and chemical properties of 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7)?

Answer

1,2,3-Propanetriyl triheptanoate
1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7) is a clear, colorless liquid at room temperature. Its molecular weight is approximately 396.45 g/mol. This compound has a low solubility in water but is soluble in organic solvents like ethanol and acetone. Chemically, it is less reactive compared to other esters, making it stable under normal conditions. It has a characteristic fragrance and is used as a flavor and fragrance ingredient in the food and cosmetic industries.

About

CAS No 620-67-7
English Name 1,2,3-Propanetriyl triheptanoate
Molecular Formula C24H44O6
Molecular Weight 428.61 g/mol
SMILES CCCCCCC(=O)OCC(COC(=O)CCCCCC)OC(=O)CCCCCC
InChIKey PJHKBYALYHRYSK-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7) typically synthesized?

1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7) is typically synthesized by esterification of hepta...

Compound Q&A

What industries use 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7)?

1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7) is commonly used in the food and cosmetic industrie...

Compound Q&A

What precautions should be taken when handling 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7)?

When handling 1,2,3-Propanetriyl triheptanoate (CAS: 620-67-7), it is important to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...