Compound Q&A

What industries use (3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate (CAS: 35730-78-0)?

Answer

(3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate
This compound finds applications in the pharmaceutical industry for its potential use in drug synthesis, particularly in the development of new pharmaceuticals due to its unique chemical properties. It is also used in polymer synthesis to enhance material properties and in the production of sensors for detecting specific chemical compounds. Additionally, it is explored for its potential use in semiconductor manufacturing due to its electronic properties.

About

CAS No 35730-78-0
English Name (3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate
Molecular Formula C19H22O6
Molecular Weight 346.37900000000013 g/mol
SMILES C=C1C[C@@H]([C@@H]2[C@H]([C@@H]3[C@H]1C[C@@H](C3=C)O)OC(=O)C2=C)OC(=O)C(=C)CO
InChIKey KHSCYOFDKADJDJ-JNNCMOEMSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is (3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate (CAS: 35730-78-0) typically synthesized?

This compound is typically synthesized via a multistep process involving the condensation of azulene...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...