Compound Q&A

What are the physical and chemical properties of (3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate (CAS: 35730-78-0)?

Answer

(3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate
The compound is a white crystalline solid with a molecular weight of approximately 338.34 g/mol. It has limited solubility in water but good solubility in common organic solvents like ethanol and acetone. Chemically, it is reactive due to the presence of the hydroxyl and acrylate groups, making it suitable for various chemical reactions. It exhibits good thermodynamic stability under normal conditions but requires mild conditions for synthesis and handling to prevent degradation.

About

CAS No 35730-78-0
English Name (3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate
Molecular Formula C19H22O6
Molecular Weight 346.37900000000013 g/mol
SMILES C=C1C[C@@H]([C@@H]2[C@H]([C@@H]3[C@H]1C[C@@H](C3=C)O)OC(=O)C2=C)OC(=O)C(=C)CO
InChIKey KHSCYOFDKADJDJ-JNNCMOEMSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is (3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate (CAS: 35730-78-0) typically synthesized?

This compound is typically synthesized via a multistep process involving the condensation of azulene...

Compound Q&A

What industries use (3aR,4S,6aR,8S,9aR,9bS)-8-Hydroxy-3,6,9-tris(methylene)-2-oxododecahydroazuleno[4,5-b]furan-4-yl 2-(hydroxymethyl)acrylate (CAS: 35730-78-0)?

This compound finds applications in the pharmaceutical industry for its potential use in drug synthe...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...