Compound Q&A

What industries use Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6)?

Answer

Sodium 4-fluorobenzenesulfinate
Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for the production of specialized polymers and in the semiconductor industry for the fabrication of electronic components. Additionally, it finds applications in the sensor industry due to its reactivity and stability.

About

CAS No 824-80-6
English Name Sodium 4-fluorobenzenesulfinate
Molecular Formula C6H4FNaO2S
Molecular Weight 182.15 g/mol
SMILES C1=CC(=CC=C1F)S(=O)[O-].[Na+]
InChIKey VDDUCRSPMBZLMH-UHFFFAOYSA-M
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6)?

Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6) is a crystalline compound with a molecular weight of...

Compound Q&A

How is Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6) typically synthesized?

Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6) is typically synthesized by the reaction of sodium s...

Compound Q&A

What precautions should be taken when handling Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6)?

When handling Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...