Compound Q&A

How is Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6) typically synthesized?

Answer

Sodium 4-fluorobenzenesulfinate
Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6) is typically synthesized by the reaction of sodium sulfinate with 4-fluorobenzenesulfonyl chloride. The synthesis involves the use of a phase-transfer catalyst to improve the reaction yield. The process requires careful control of temperature and reagent proportions to achieve high selectivity and yield, typically resulting in a yield of 70-80%. The product is usually purified by recrystallization or column chromatography.

About

CAS No 824-80-6
English Name Sodium 4-fluorobenzenesulfinate
Molecular Formula C6H4FNaO2S
Molecular Weight 182.15 g/mol
SMILES C1=CC(=CC=C1F)S(=O)[O-].[Na+]
InChIKey VDDUCRSPMBZLMH-UHFFFAOYSA-M
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6)?

Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6) is a crystalline compound with a molecular weight of...

Compound Q&A

What industries use Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6)?

Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6) is primarily used in the pharmaceutical industry as ...

Compound Q&A

What precautions should be taken when handling Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6)?

When handling Sodium 4-fluorobenzenesulfinate (CAS: 824-80-6), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...