Compound Q&A

What industries use 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1)?

Answer

3-bromo-5-(trifluoromethyl)pyridin-2-ol
3-Bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1) is used in various industries, including pharmaceuticals, where it serves as a key intermediate for the synthesis of complex molecules. It is also utilized in the production of polymers and sensors due to its unique chemical properties. In the semiconductor industry, it finds application as a chemical vapor deposition (CVD) precursor. Its versatility makes it a valuable compound in materials science and organic chemistry research.

About

CAS No 76041-73-1
English Name 3-bromo-5-(trifluoromethyl)pyridin-2-ol
Molecular Formula C6H3BrF3NO
Molecular Weight 241.99 g/mol
SMILES C1=C(C(=O)NC=C1C(F)(F)F)Br
InChIKey UWHKLLYQUQPOQK-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1)?

3-Bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1) is a crystalline compound with a molecular...

Compound Q&A

How is 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1) typically synthesized?

3-Bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1) is typically synthesized through a multi-s...

Compound Q&A

What precautions should be taken when handling 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1)?

When handling 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...