Compound Q&A

How is 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1) typically synthesized?

Answer

3-bromo-5-(trifluoromethyl)pyridin-2-ol
3-Bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1) is typically synthesized through a multi-step process involving bromination and fluorination reactions. A common method involves bromination of 5-(trifluoromethyl)pyridine followed by hydroxylation to form the desired compound. The synthesis can be carried out with the use of a Lewis acid catalyst, such as aluminum bromide, and requires careful control of reaction conditions to achieve high selectivity and yield. The process is often optimized using techniques such as column chromatography for purification.

About

CAS No 76041-73-1
English Name 3-bromo-5-(trifluoromethyl)pyridin-2-ol
Molecular Formula C6H3BrF3NO
Molecular Weight 241.99 g/mol
SMILES C1=C(C(=O)NC=C1C(F)(F)F)Br
InChIKey UWHKLLYQUQPOQK-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1)?

3-Bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1) is a crystalline compound with a molecular...

Compound Q&A

What industries use 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1)?

3-Bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1) is used in various industries, including p...

Compound Q&A

What precautions should be taken when handling 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1)?

When handling 3-bromo-5-(trifluoromethyl)pyridin-2-ol (CAS: 76041-73-1), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...