Compound Q&A

What industries use 2-Methoxy-3-nitropyridine (CAS: 20265-35-4)?

Answer

2-Methoxy-3-nitropyridine
2-Methoxy-3-nitropyridine is used in various industries, including pharmaceuticals for the synthesis of drug intermediates, polymer production for special chemical applications, and as a precursor in sensor and semiconductor manufacturing processes. Its versatile chemical properties make it valuable in these sectors.

About

CAS No 20265-35-4
English Name 2-Methoxy-3-nitropyridine
Molecular Formula C6H6N2O3
Molecular Weight 154.12 g/mol
EINECS 654-159-1
SMILES COC1=C(C=CC=N1)[N+](=O)[O-]
InChIKey WZNQCVOSOCGWJG-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-3-nitropyridine (CAS: 20265-35-4)?

2-Methoxy-3-nitropyridine is a crystalline solid with a molecular weight of approximately 186.12 g/m...

Compound Q&A

How is 2-Methoxy-3-nitropyridine (CAS: 20265-35-4) typically synthesized?

2-Methoxy-3-nitropyridine is typically synthesized by nitration of 2-methoxypyridine followed by red...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-3-nitropyridine (CAS: 20265-35-4)?

When handling 2-Methoxy-3-nitropyridine, it is essential to wear personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...