Compound Q&A

What are the physical and chemical properties of 2-Methoxy-3-nitropyridine (CAS: 20265-35-4)?

Answer

2-Methoxy-3-nitropyridine
2-Methoxy-3-nitropyridine is a crystalline solid with a molecular weight of approximately 186.12 g/mol. It is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. Chemically, it is reactive towards reducing agents and can undergo substitution and reduction reactions. Its physical properties include a melting point of around 124-126°C.

About

CAS No 20265-35-4
English Name 2-Methoxy-3-nitropyridine
Molecular Formula C6H6N2O3
Molecular Weight 154.12 g/mol
EINECS 654-159-1
SMILES COC1=C(C=CC=N1)[N+](=O)[O-]
InChIKey WZNQCVOSOCGWJG-UHFFFAOYSA-N
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is 2-Methoxy-3-nitropyridine (CAS: 20265-35-4) typically synthesized?

2-Methoxy-3-nitropyridine is typically synthesized by nitration of 2-methoxypyridine followed by red...

Compound Q&A

What industries use 2-Methoxy-3-nitropyridine (CAS: 20265-35-4)?

2-Methoxy-3-nitropyridine is used in various industries, including pharmaceuticals for the synthesis...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-3-nitropyridine (CAS: 20265-35-4)?

When handling 2-Methoxy-3-nitropyridine, it is essential to wear personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...