Compound Q&A

What precautions should be taken when handling pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

Answer

Pentachlorobenzenethiol zinc salt
When handling pentachlorobenzenethiol zinc salt (CAS: 117-97-5), it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. This compound should be stored in a well-ventilated area away from heat sources. Spills should be handled with proper containment and cleaned up using appropriate chemicals or absorbents. Always refer to the safety data sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 117-97-5
English Name Pentachlorobenzenethiol zinc salt
Molecular Formula C12Cl10S2Zn
Molecular Weight 628.2 g/mol
SMILES C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)[S-].C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)[S-].[Zn+2]
InChIKey ONSIBMFFLJKTPT-UHFFFAOYSA-L
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is a crystalline solid with a high molecular weigh...

Compound Q&A

How is pentachlorobenzenethiol zinc salt (CAS: 117-97-5) typically synthesized?

Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is typically synthesized through the reaction of z...

Compound Q&A

What industries use pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is used in various industries, including pharmaceu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...