Compound Q&A

What are the physical and chemical properties of Pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

Answer

Pentachlorobenzenethiol zinc salt
Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is a crystalline solid with a high molecular weight. It is poorly soluble in water but soluble in organic solvents. This compound is known for its high reactivity with various nucleophiles and electrophiles. It has a melting point of around 160°C and a low vapor pressure, ensuring it is stable under normal conditions.

About

CAS No 117-97-5
English Name Pentachlorobenzenethiol zinc salt
Molecular Formula C12Cl10S2Zn
Molecular Weight 628.2 g/mol
SMILES C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)[S-].C1(=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl)[S-].[Zn+2]
InChIKey ONSIBMFFLJKTPT-UHFFFAOYSA-L
Last Updated: 2025-10-08 00:58

Related Q&A

Compound Q&A

How is pentachlorobenzenethiol zinc salt (CAS: 117-97-5) typically synthesized?

Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is typically synthesized through the reaction of z...

Compound Q&A

What industries use pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

Pentachlorobenzenethiol zinc salt (CAS: 117-97-5) is used in various industries, including pharmaceu...

Compound Q&A

What precautions should be taken when handling pentachlorobenzenethiol zinc salt (CAS: 117-97-5)?

When handling pentachlorobenzenethiol zinc salt (CAS: 117-97-5), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...